| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Poly(ethylene glycol)-block-polylactide methyl ether
Purity:PEG average Mn 350, PLA average Mn 1,000 Package:1G Remarks:659665-1G
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Purity:PEG average Mn 350, PLA average Mn 1,000
|
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
| Products Intro: |
|
|
| | PEG-B-PLA Basic information |
| Product Name: | PEG-B-PLA | | Synonyms: | Poly(ethylene glycol)-block-polylactide methyl ether PEG average Mn 350, PLA average Mn 1,000;POLY(ETHYLENE GLYCOL)-BLOCK-POLYLACTIDE METHYL ETHER;PEG-B-PLA | | CAS: | | | MF: | CH3O(CH2CH2O)x(COCHCH3O)yH | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![PEG-B-PLA Structure]() |
| | PEG-B-PLA Chemical Properties |
| | PEG-B-PLA Usage And Synthesis |
| | PEG-B-PLA Preparation Products And Raw materials |
|