|
|
| | (R,R)-1,2-bis(methanesulfonyloxymethyl)cyclohexane Basic information |
| Product Name: | (R,R)-1,2-bis(methanesulfonyloxymethyl)cyclohexane | | Synonyms: | (R,R)-1,2-bis(methanesulfonyloxymethyl)cyclohexane;(1R-trans)-1,2-Cyclohexanedimethanol dimethanesulfonate;(-)-(1R,2R)-bis(Methanesulfonyloxy-Methyl) cyclohexane;(1R,2R)-1,2-Bis(MethanesulfonyloxyMethyl)cyclohexan;(R,R)-1,2-Bis(MethanesulphonyloxyMethyl)cyclohexane;-1,2-Bis(Methanesulphonyloxymethyl);(1R,2R)-Trans-1,2 bis (methan sulfonyl-oxymethyl) Cyclohexane;[(1R,2R)-2-(methylsulfonyloxymethyl)cyclohexyl]methyl methanesulfonate | | CAS: | 186204-35-3 | | MF: | C10H20O6S2 | | MW: | 300.39 | | EINECS: | 1308068-626-2 | | Product Categories: | Sulfur & Selenium Compounds | | Mol File: | 186204-35-3.mol |  |
| | (R,R)-1,2-bis(methanesulfonyloxymethyl)cyclohexane Chemical Properties |
| Melting point | 86-90°C | | Boiling point | 495.3±18.0 °C(Predicted) | | density | 1.270 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C10H20O6S2/c1-17(11,12)15-7-9-5-3-4-6-10(9)8-16-18(2,13)14/h9-10H,3-8H2,1-2H3/t9-,10-/s3 | | InChIKey | JIHKCHWEXXZTOU-DPIMBTEZNA-N | | SMILES | [C@@H]1(COS(=O)(=O)C)CCCC[C@H]1COS(=O)(=O)C |&1:0,11,r| |
| | (R,R)-1,2-bis(methanesulfonyloxymethyl)cyclohexane Usage And Synthesis |
| Chemical Properties | Off-white Solid | | Uses | (1R,2R)-1,2-Cyclohexanedimethanol 1,2-Dimethanesulfonate (cas# 186204-35-3) is a compound useful in organic synthesis. |
| | (R,R)-1,2-bis(methanesulfonyloxymethyl)cyclohexane Preparation Products And Raw materials |
|