3-UNDECANOL manufacturers
- 3-Undecanol
-
- $0.00 / 25KG
-
2024-03-28
- CAS:6929-08-4
- Min. Order: 25KG
- Purity: 95%
- Supply Ability: Inquiry
- 3-UNDECANOL
-
- $2.00 / 1KG
-
2019-12-26
- CAS:6929-08-4
- Min. Order: 1KG
- Purity: 98%MIN
- Supply Ability: ASK
|
| | 3-UNDECANOL Basic information |
| Product Name: | 3-UNDECANOL | | Synonyms: | undecan-3-ol;UNDECANOL-3;3-UNDECANOL;3-Hendecanol;3-Hendecyl alcohol;Ethyloctylcarbinol;Undecane-3-ol;Ethyl n-octyl carbinol | | CAS: | 6929-08-4 | | MF: | C11H24O | | MW: | 172.31 | | EINECS: | 230-054-2 | | Product Categories: | | | Mol File: | 6929-08-4.mol |  |
| | 3-UNDECANOL Chemical Properties |
| Melting point | 11.58°C (estimate) | | Boiling point | 132 °C / 13mmHg | | density | 0.83 | | refractive index | 1.4370-1.4390 | | Fp | 38 °C | | pka | 15.29±0.20(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C11H24O/c1-3-5-6-7-8-9-10-11(12)4-2/h11-12H,3-10H2,1-2H3 | | InChIKey | HCARCYFXWDRVBZ-UHFFFAOYSA-N | | SMILES | CCC(O)CCCCCCCC | | LogP | 4.249 (est) |
| RIDADR | 1987 | | HS Code | 2905.19.9090 | | HazardClass | 3 | | PackingGroup | III |
| | 3-UNDECANOL Usage And Synthesis |
| | 3-UNDECANOL Preparation Products And Raw materials |
|