| Company Name: |
ChengDu TongChuangYuan Pharmaceutical Co.Ltd
|
| Tel: |
028-83379370 13880556291 |
| Email: |
tcy@tcypharm.com |
| Products Intro: |
Product Name:1,2-Dihydro-4-methyl-2-oxo-7-quinolinecarboxylic acid
CAS:124281-65-8
Package:1kg
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-66113011 18112977050 |
| Email: |
cb6@aikonchem.com |
| Products Intro: |
Product Name:7-Quinolinecarboxylicacid,1,2-dihydro-4-methyl-2-oxo-(9CI)
CAS:124281-65-8
Purity:95% HPLC or GC Package:10G,5G;1G
|
| Company Name: |
Neostar United (Changzhou) Industrial Co., Ltd.
|
| Tel: |
0519-85551759 13376258932 |
| Email: |
project@neostarunited.com |
| Products Intro: |
Product Name:1,2-Dihydro-4-methyl-2-oxo-7-quinolinecarboxylic acid
CAS:124281-65-8
Purity:211%，HPLC Package:吨，500kg，100kg，5kg，113kg
|
|
| | 7-Quinolinecarboxylicacid,1,2-dihydro-4-methyl-2-oxo-(9CI) Basic information |
| | 7-Quinolinecarboxylicacid,1,2-dihydro-4-methyl-2-oxo-(9CI) Chemical Properties |
| Melting point | 250 °C (decomp) | | Boiling point | 458.4±45.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | pka | 4.03±0.20(Predicted) | | InChI | InChI=1S/C11H9NO3/c1-6-4-10(13)12-9-5-7(11(14)15)2-3-8(6)9/h2-5H,1H3,(H,12,13)(H,14,15) | | InChIKey | BZOSLZIOHCOEKR-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(C(O)=O)=C2)C(C)=CC1=O |
| | 7-Quinolinecarboxylicacid,1,2-dihydro-4-methyl-2-oxo-(9CI) Usage And Synthesis |
| | 7-Quinolinecarboxylicacid,1,2-dihydro-4-methyl-2-oxo-(9CI) Preparation Products And Raw materials |
|