| Company Name: |
Chemwill Asia Co.,Ltd.
|
| Tel: |
86-21-51086038 |
| Email: |
chemwill_asia@126.com |
| Products Intro: |
CAS:104558-95-4
Purity:99% Package:5KG;1KG;25KG PRICE quotation Remarks:Factory stock, quality assurance, price concessions
|
| Company Name: |
Qingdao Riverside New Materials Co., Ltd. Gold
|
| Tel: |
0532-80932738 15689126900 |
| Email: |
info@rivmat.com |
| Products Intro: |
Product Name:Mixed triarylsulfonium hexafluorophosphate salts (45%) in propylene
carbonate (55%)
CAS:104558-95-4
Purity:45% Package:25G;1KG
|
|
| | IHT-PI 432 Basic information |
| Product Name: | IHT-PI 432 | | Synonyms: | Cyracure 6990;Cyracure UVI 6990;UV 16990;UVI 6990;YF-PI 6992;Photoinitiator-6992;Mixed Triarylsulfonium Hexafluorophosphate Salts;Mixed triarylsulfonium hexafluorophosphate salts (45%) in propylene
carbonate (55%) | | CAS: | 104558-95-4 | | MF: | C18H15F6PS | | MW: | 408.3408802 | | EINECS: | | | Product Categories: | | | Mol File: | 104558-95-4.mol |  |
| | IHT-PI 432 Chemical Properties |
| InChI | InChI=1S/C18H15S.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 | | InChIKey | OFOZWFGJJSDVIP-UHFFFAOYSA-N | | SMILES | [S+](C1C([H])=C([H])C([H])=C([H])C=1[H])(C1C([H])=C([H])C([H])=C([H])C=1[H])C1C([H])=C([H])C([H])=C([H])C=1[H].[P-](F)(F)(F)(F)(F)F |
| | IHT-PI 432 Usage And Synthesis |
| | IHT-PI 432 Preparation Products And Raw materials |
|