| Identification | Back Directory | [Name]
2-Fluoro-5-methoxy-4-nitrobenzoic acid | [CAS]
1001345-80-7 | [Synonyms]
2-Fluoro-5-methoxy-4-nitrobenzoic acid Benzoic acid, 2-fluoro-5-methoxy-4-nitro- | [Molecular Formula]
C8H6FNO5 | [MDL Number]
MFCD26395470 | [MOL File]
1001345-80-7.mol | [Molecular Weight]
215.14 |
| Chemical Properties | Back Directory | [Boiling point ]
413.0±45.0 °C(Predicted) | [density ]
1.514±0.06 g/cm3(Predicted) | [pka]
2.25±0.13(Predicted) | [InChI]
InChI=1S/C8H6FNO5/c1-15-7-2-4(8(11)12)5(9)3-6(7)10(13)14/h2-3H,1H3,(H,11,12) | [InChIKey]
JXCYBTVSPGQRCM-UHFFFAOYSA-N | [SMILES]
C(O)(=O)C1=CC(OC)=C([N+]([O-])=O)C=C1F |
| Hazard Information | Back Directory | [Synthesis]
2-Fluoro-5-methoxy-4-nitrobenzoic acid can be synthesized using various methods such as the Friedel-Crafts acylation reaction, the Suzuki-Miyaura coupling reaction, and the Buchwald-Hartwig amination reaction. The Friedel-Crafts acylation reaction involves the reaction of 2-fluoro-5-methoxy-4-nitrobenzoyl chloride with methanol in the presence of a catalyst such as aluminum chloride. The Suzuki-Miyaura coupling reaction involves the reaction of 2-fluoro-5-methoxy-4-nitrophenylboronic acid with 4-chlorobenzoic acid in the presence of a palladium catalyst. The Buchwald-Hartwig amination reaction involves the reaction of 2-fluoro-5-methoxy-4-nitroiodobenzene with potassium phthalimide in the presence of a palladium catalyst. |
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|