| Identification | Back Directory | [Name]
TRIETHYL PHOSPHONOACETATE-13C2 | [CAS]
100940-60-1 | [Synonyms]
TRIETHYL PHOSPHONOACETATE-13C2 13C Labeled triethyl phosphonoacetate TRIETHYL PHOSPHONOACETATE-13C2, 99 ATOM % 13C (Diethoxyphosphinyl)acetic-13C2 acid ethyl ester | [Molecular Formula]
C8H17O5P | [MDL Number]
MFCD00064452 | [MOL File]
100940-60-1.mol | [Molecular Weight]
226.21 |
| Chemical Properties | Back Directory | [Boiling point ]
142-145 °C/9 mmHg (lit.) | [density ]
1.13 g/mL at 25 °C (lit.) | [refractive index ]
n20/D 1.431(lit.) | [Fp ]
>230 °F | [InChI]
1S/C8H17O5P/c1-4-11-8(9)7-14(10,12-5-2)13-6-3/h4-7H2,1-3H3/i7+1,8+1 | [InChIKey]
GGUBFICZYGKNTD-BFGUONQLSA-N | [SMILES]
CCO[13C](=O)[13CH2]P(=O)(OCC)OCC |
| Hazard Information | Back Directory | [Uses]
Triethyl Phosphonoacetate-13C2 is the isotope labelled analog of Triethyl Phosphonoacetate (T777000). Triethyl Phosphonoacetate is a reagent used for Horner-Emmons modification. | [reaction suitability]
reaction type: C-C Bond Formation reaction type: Olefinations |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|