| Identification | Back Directory | [Name]
2,3,5-Tri-O-benzoyl-1-O-acetyl-4-thio-D-ribofuranose | [CAS]
1015447-26-3 | [Synonyms]
2,3,5-Tri-O-benzoyl-1-O-acetyl-4-thio-D-ribofuranose
b-D-Ribofuranose, 4-thio-, 1-acetate 2,3,5-tribenzoate
4-Thio-beta-D-ribofuranose 1-acetate 2,3,5-tribenzoate
1-O-Acetyl-2,3,5-tri-O-benzoyl-4-thio-b-D-ribofuranose
1-O-acetyl-2,3,5-tri-O-benzoyl-4-thio-β-D-ribofuranose
β-D-Ribofuranose, 4-thio-, 1-acetate 2,3,5-tribenzoate
(3R,4S,5R)-2-Acetoxy-5-((benzoyloxy)methyl)tetrahydrothiophene-3,4-diyl dibenzoate | [Molecular Formula]
C28H24O8S | [MDL Number]
MFCD22666333 | [MOL File]
1015447-26-3.mol | [Molecular Weight]
520.55 |
| Chemical Properties | Back Directory | [Melting point ]
159-160 °C(Solv: methanol (67-56-1)) | [Boiling point ]
641.1±55.0 °C(Predicted) | [density ]
1.36±0.1 g/cm3(Predicted) | [InChIKey]
ACUZOAXNZDOSKC-CBUXHAPBSA-N | [SMILES]
O(C(C)=O)[C@@H]1S[C@H](COC(=O)C2=CC=CC=C2)[C@@H](OC(=O)C2=CC=CC=C2)[C@H]1OC(=O)C1=CC=CC=C1 |
| Hazard Information | Back Directory | [Description]
1-O-Acetyl-2,3,5-tri-O-benzoyl-4-thio-b-D-ribofuranose (2,3,5-Tri-O-benzoyl-1-O-acetyl-4-thio-D-ribofuranose), an essential biochemical, serves as a vital intermediary in synthesizing nucleotides and nucleosides such as antiviral and anticancer drugs, such as AZT and FdUrd. Moreover, it acts as a crucial reagent in the creation of modified RNA and DNA oligonucleotides, which enable the possible cure of genetic and metabolic disorders, thereby demonstrating its therapeutic potential.
|
|
|