| Identification | Back Directory | [Name]
(R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diamine | [CAS]
1041434-65-4 | [Synonyms]
(R)-1,1'-spirobiindane-7,7'-diamine
(R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine
(R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diamine
(1R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diamine
1,1'-Spirobi[1H-indene]-7,7'-diamine, 2,2',3,3'-tetrahydro-, (1R)-
(R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diamine, 98%, (99% ee) | [Molecular Formula]
C17H18N2 | [MDL Number]
MFCD16660945 | [MOL File]
1041434-65-4.mol | [Molecular Weight]
250.34 |
| Chemical Properties | Back Directory | [Melting point ]
167-168 °C | [Boiling point ]
456.6±45.0 °C(Predicted) | [density ]
1.24±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [pka]
4.57±0.20(Predicted) | [Appearance]
Off-white to light yellow Solid | [Optical Rotation]
Consistent with structure | [InChI]
InChI=1S/C17H18N2/c18-13-5-1-3-11-7-9-17(15(11)13)10-8-12-4-2-6-14(19)16(12)17/h1-6H,7-10,18-19H2 | [InChIKey]
LXEAIMHQRXRIGO-UHFFFAOYSA-N | [SMILES]
[C@@]12(C3=C(C=CC=C3N)CC1)C1=C(C=CC=C1N)CC2 |
|
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|