| Identification | Back Directory | [Name]
4-Bromo-2-chlorophenylboronic acid | [CAS]
1046861-20-4 | [Synonyms]
(4-Bromo-2-chlorophenyl) 4-Bromo-2-chlorophenylboronic acid 4-bromo-2-chlorobenzeneboronic acid Boronic acid, B-(4-bromo-2-chlorophenyl)- 4-Bromo-2-chlorophenylboronic acid(contains varying amounts of Anhydride) | [Molecular Formula]
C6H5BBrClO2 | [MDL Number]
MFCD13195646 | [MOL File]
1046861-20-4.mol | [Molecular Weight]
235.27 |
| Chemical Properties | Back Directory | [Boiling point ]
347.3±52.0 °C(Predicted) | [density ]
1.79±0.1 g/cm3(Predicted) | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [pka]
8.02±0.58(Predicted) | [Appearance]
White to light yellow Solid |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
parabiochem
|
| Tel: |
025-83453382-8005 |
| Website: |
www.parabiochem.cn |
|