| Identification | Back Directory | [Name]
bis(tert-butyldicylcohexylphosphine)dichloropalladium(II) | [CAS]
104889-13-6 | [Synonyms]
CX82 bis(tert-butyldicylcohexylphosphine)dichloropalladium(II) Dichlorobis[(tert-butyl)dicyclohexylphosphine]palladium(II) bis(tert-butyldicyclohexyl-l5-phosphaneyl)palladium(IV)chloride | [EINECS(EC#)]
813-741-7 | [Molecular Formula]
C32H64Cl2P2Pd | [MOL File]
104889-13-6.mol | [Molecular Weight]
688.13 |
| Chemical Properties | Back Directory | [Melting point ]
>300 °C | [form ]
powder | [InChI]
InChI=1S/2C16H31P.2ClH.Pd/c2*1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15;;;/h2*14-15H,4-13H2,1-3H3;2*1H; | [InChIKey]
UXEDXFSHGPWQJZ-UHFFFAOYSA-N | [SMILES]
P(C1CCCCC1)(C1CCCCC1)(C(C)(C)C)[Pd+2]([Cl-])([Cl-])P(C1CCCCC1)(C1CCCCC1)C(C)(C)C |
| Hazard Information | Back Directory | [Uses]
Umicore CX82 is a homogeneous catalyst useful for cross coupling reactions with arenes and Suzuki-Miyaura cross coupling. | [reaction suitability]
reagent type: catalyst reaction type: Cross Couplings |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
|