| Identification | Back Directory | [Name]
Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid | [CAS]
1054451-31-8 | [Synonyms]
TPE-BA [(1,2-Diphenylethene-1,2-diyl)bis(4,1-phenylene)]diboronic acid 4,4'-(1,2-diphenylethene-1,2-diyl)bis(4,1-phenylene)diboronic acid 4,4'-(1,2-Diphenylethene-1,2-diyl)bis(1,4-phenylene)diboronic acid 4,4'-(1,2-diphenylethene-1,2-diyl)bis(1,4-phenylene)diboronic acid (1,2-diphenylethene-1,2-diyl)bis(4,4'-phenylene)-1,1'-diboronic acid Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis- Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid | [Molecular Formula]
C26H22B2O4 | [MOL File]
1054451-31-8.mol | [Molecular Weight]
420.07 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C | [form ]
solid | [InChI]
1S/C26H22B2O4/c29-27(30)23-15-11-21(12-16-23)25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)22-13-17-24(18-14-22)28(31)32/h1-18,29-32H/b26-25+ | [InChIKey]
CFKHFTZRFSABDV-OCEACIFDSA-N | [SMILES]
OB(O)C(C=C1)=CC=C1/C(C2=CC=CC=C2)=C(C3=CC=C(B(O)O)C=C3)\C4=CC=CC=C4 |
| Hazard Information | Back Directory | [Uses]
TPE-BA is an aggregation-induced emission (AIE) dye for use in Suzuki reaction and D-Glucose detection. | [General Description]
Aggregation-induced emission luminogens (AIEgens) such as tetraphenylethene (TPE) functionalized with boronic acids form luminogen (TPE-BA). TPE-BA can form oligoboronates with D-glucose. Other sugars also form monoadduct with TPE-BA, but once such a complex is formed there is no more cis-diol that allows the oligomerization reaction to proceed, resulting in a very low emission intensity. Thus, TPE-BA could serve as a glucose-specific probe. |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shanghai Uchem Inc.
|
| Telephone: |
15618758386 15618758386 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList15300/0_EN.htm |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|