| Identification | Back Directory | [Name]
(5-(4-Fluorophenyl)thiophen-2-yl)(5-iodo-2-Methylphenyl)Methanone | [CAS]
1071929-08-2 | [Synonyms]
2-(5-Iodo-2-Methylbenzoyl)-5-(4-fluorophenyl)thiophene [5-(4-Fluorophenyl)-2-thienyl](5-iodo-2-methylphenyl)-methanone Methanone,[5-(4-fluorophenyl)-2-thienyl](5-iodo-2-methylphen... Methanone,[5-(4-fluorophenyl)-2-thienyl](5-iodo-2-methylphenyl)- [5-(4-Fluorophenyl)thiophene-yl](5-iodo-2-Methylphenyl)Methanone [5-(4-fluorophenyl)-2-thienyl](5-iodo-2-methylphenyl)-methyketone (5-(4-Fluorophenyl)thiophen-2-yl)(5-iodo-2-Methylphenyl)Methanone Canagliflozin impurity FQ: What is
Canagliflozin impurity F Q: What is the CAS Number of
Canagliflozin impurity F Q: What is the storage condition of
Canagliflozin impurity F | [EINECS(EC#)]
924-156-2 | [Molecular Formula]
C18H12FIOS | [MDL Number]
MFCD12405594 | [MOL File]
1071929-08-2.mol | [Molecular Weight]
422.26 |
| Chemical Properties | Back Directory | [Boiling point ]
491.4±45.0 °C(Predicted) | [density ]
1.594±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C(protect from light) | [InChI]
InChI=1S/C18H12FIOS/c1-11-2-7-14(20)10-15(11)18(21)17-9-8-16(22-17)12-3-5-13(19)6-4-12/h2-10H,1H3 | [InChIKey]
UCEUYWYTFYVWBY-UHFFFAOYSA-N | [SMILES]
C(C1SC(C2=CC=C(F)C=C2)=CC=1)(C1=CC(I)=CC=C1C)=O |
|
| Company Name: |
JOYCHINE BIO-TECH Gold
|
| Telephone: |
18680818008 |
| Website: |
http://www.extiki.com |
| Company Name: |
Sicemo Ltd.
|
| Telephone: |
0532-85625977 13668866880 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList14054/0_EN.htm |
| Company Name: |
BePharm Ltd
|
| Telephone: |
400-685-9117 |
| Website: |
www.bepharm.com |
|