| Identification | Back Directory | [Name]
TRANS-4-(TRIFLUOROMETHYL)CYCLOHEXANAMINE | [CAS]
1073266-02-0 | [Synonyms]
Cyclohexanamine, 4-(trifluoromethyl)- trans-4-Trifluoromethyl-cyclohexylamine TRANS-4-(TRIFLUOROMETHYL)CYCLOHEXANAMINE (1r,4r)-4-(trifluoromethyl)cyclohexanamine TRANS-4-(TRIFLUOROMETHYL)CYCLOHEXAN-1-AMINE Cyclohexanamine, 4-(trifluoromethyl)-, trans- (1R,4R)-4-(Trifluoromethyl)cyclohexan-1-amine rel-((1R,4R)-4-(Trifluoromethyl)cyclohexanamine) | [Molecular Formula]
C7H12F3N | [MDL Number]
MFCD18914322 | [MOL File]
1073266-02-0.mol | [Molecular Weight]
167.172 |
| Chemical Properties | Back Directory | [Boiling point ]
145.1±35.0 °C(Predicted) | [density ]
1.136±0.06 g/cm3(Predicted) | [refractive index ]
1.4040 to 1.4080 | [form ]
clear liquid | [pka]
10.29±0.70(Predicted) | [color ]
Colorless to Light orange to Yellow | [InChI]
InChI=1S/C7H12F3N/c8-7(9,10)5-1-3-6(11)4-2-5/h5-6H,1-4,11H2/t5-,6- | [InChIKey]
YCBWLMWEQURJHX-IZLXSQMJSA-N | [SMILES]
[C@@H]1(N)CC[C@@H](C(F)(F)F)CC1 | [CAS DataBase Reference]
1073266-02-0 |
|
| Company Name: |
TCI Chemicals
|
| Telephone: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
|