| Identification | Back Directory | [Name]
(R)-3,3'-BIS(TRIPHENYLSILYL)-1,1'-BI-2-& | [CAS]
111822-69-6 | [Synonyms]
(R)-3,3'-BIS(TRIPHENYLSILYL)-1,1'-BI-2-& (R)-3,3μ-Bis(triphenylsilyl)-1,1μ-bi-2-naphthol (R)-3,3'-Bis(triphenylsilyl)-1,1'-bi-2-naphthol 96% (R)-(+)-3,3'-Bis(triphenylsilyl)-1,1'-bi-2,2'-naphthol (R)-3,3'-Bis(triphenylsilyl)-1,1'-bi-2-naphthol, 99%e.e. (R)-3,3μ-Bis(triphenylsilyl)-1,1μ-binaphthalene-2,2μ-diol (1R)-3,3'- bis (triphenylsilyl) [1,1'- binaphthyl ]-2,2'- diol [1,1'-Binaphthalene]-2,2'-diol, 3,3'-bis(triphenylsilyl)-, (1R)- | [Molecular Formula]
C56H42O2Si2 | [MDL Number]
MFCD09265078 | [MOL File]
111822-69-6.mol | [Molecular Weight]
803.1 |
| Chemical Properties | Back Directory | [Melting point ]
103-145 °C | [density ]
1.27±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
solid | [pka]
8.06±0.50(Predicted) | [Appearance]
White to off-white Solid | [Optical Rotation]
[α]20/D +114°, c = 1 in chloroform | [InChIKey]
STBZSRVMGWTCOU-UHFFFAOYSA-N | [SMILES]
Oc1c(cc2ccccc2c1-c3c(O)c(cc4ccccc34)[Si](c5ccccc5)(c6ccccc6)c7ccccc7)[Si](c8ccccc8)(c9ccccc9)c%10ccccc%10 |
| Hazard Information | Back Directory | [Chemical Properties]
White powder | [Uses]
Precursor to a chiral Bronsted acid (674745) used to catalyze an enantioselective aza Diels-Alder reaction providing bicyclic lactams. Rare earth metal complexes of this chiral binapthol catalyze an intramolecular hydroamination of amino olefins leading to chiral pyrrolidines. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|