| Identification | Back Directory | [Name]
3-Methacrylamidopropyl Tris(Trimethylsiloxy)Silane | [CAS]
115257-95-9 | [Synonyms]
Tris(trimethylsiloxy)silylpropylmethacrylamide 3-Methacrylamidopropyl Tris(Trimethylsiloxy)Silane 2-Propenamide, 2-methyl-N-[3-[3,3,3-trimethyl-1,1-bis[(trimethylsilyl)oxy]-1-disiloxanyl]propyl]- 3-Methacrylamidopropyltris(trimethylsiloxy)silane >95%, stabilized with 4-Methoxyphenol, 50-500 ppm | [Molecular Formula]
C16H39NO4Si4 | [MDL Number]
MFCD29067130 | [MOL File]
115257-95-9.mol | [Molecular Weight]
421.83 |
| Chemical Properties | Back Directory | [Boiling point ]
130-133°C / 0.5 | [density ]
0.926±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [form ]
liquid | [pka]
15.01±0.46(Predicted) | [Hydrolytic Sensitivity]
4: no reaction with water under neutral conditions | [InChI]
InChI=1S/C16H39NO4Si4/c1-15(2)16(18)17-13-12-14-25(19-22(3,4)5,20-23(6,7)8)21-24(9,10)11/h1,12-14H2,2-11H3,(H,17,18) | [InChIKey]
IHNDNMHBSSSIPV-UHFFFAOYSA-N | [SMILES]
C(NCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)(=O)C(C)=C |
| Hazard Information | Back Directory | [Uses]
This monomer is commonly used in the formulation of research silicone hydrogel contact lenses and other research ophthalmic devices. Silicone monomers are preferred for the synthesis of research ophthalmic materials due to their high oxygen permeability. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|