| Identification | Back Directory | [Name]
2-[4-(3-CHLORO-2-HYDROXYPROPOXY)PHENYL]ACETAMIDE | [CAS]
115538-83-5 | [Synonyms]
Atenlol Imp D ATENOLOL IMP D Atenlol Impurity D Atenolol Impurity 4 ATENOLOL IMPURITY D Atenolol IMpurity –D (EP) 2-[4-[(2RS)-3-Chloro-2-hydroxypropo Atenolol Impurity 4(Atenolol EP Impurity D) 4-(3-Chloro-2-hydroxypropoxy) benzeneacetamide Benzeneacetamide, 4-(3-chloro-2-hydroxypropoxy)- 2-[4-(3-CHLORO-2-HYDROXYPROPOXY)PHENYL]ACETAMIDE 2-[4-[(2RS)-3-CHLORO-2-HYDROXYPROPOXY]PHENYL]ACETAMIDE mp. D (EP):2-[4-[(2RS)-3-Chloro-2-hydroxypropoxy]phenyl]acetamide 4-(3-Chloro-2-hydroxypropoxy)benzeneacetaMide
(Atenolol IMpurity D) 4-(3-Chloro-2-hydroxypropoxy)benzeneacetamide \n(Atenolol Impurity D) Atenolol EP Impurity DQ: What is
Atenolol EP Impurity D Q: What is the CAS Number of
Atenolol EP Impurity D Q: What is the storage condition of
Atenolol EP Impurity D Q: What are the applications of
Atenolol EP Impurity D | [Molecular Formula]
C11H14ClNO3 | [MDL Number]
MFCD02169848 | [MOL File]
115538-83-5.mol | [Molecular Weight]
243.69 |
| Chemical Properties | Back Directory | [Melting point ]
139 - 141°C | [Boiling point ]
492.5±40.0 °C(Predicted) | [density ]
1.287±0.06 g/cm3(Predicted) | [storage temp. ]
Refrigerator | [solubility ]
DMSO (Slightly), Methanol (Slightly) | [form ]
Solid | [pka]
13.11±0.20(Predicted) | [color ]
White to Off-White | [InChI]
1S/C11H14ClNO3/c12-6-9(14)7-16-10-3-1-8(2-4-10)5-11(13)15/h1-4,9,14H,5-7H2,(H2,13,15) | [InChIKey]
OQFMSHFNOSFLJU-UHFFFAOYSA-N | [SMILES]
ClCC(O)COc1ccc(cc1)CC(=O)N |
| Hazard Information | Back Directory | [Uses]
4-(3-Chloro-2-hydroxypropoxy)benzeneacetamide is an impurity of Atenolol (A790075), a cardioselective β-adrenergic blocker. | [Uses]
4-(3-Chloro-2-hydroxypropoxy)benzeneacetamide is an impurity of Atenolol (A790075), a cardioselective β-adrenergic blocker. Atenolol EP Impurity D |
|
| Company Name: |
Besil Chem LLP
|
| Tel: |
+91-7760252666 +91-9880731835 |
| Website: |
www.besilchem.com |
| Company Name: |
OPULENT PHARMA
|
| Tel: |
+91-9106692785 |
| Website: |
www.www.NOWEBSITE |
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
SynAsst Chemical.
|
| Tel: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
|