| Identification | Back Directory | [Name]
1-(5-Hydroxypyrazin-2-yl)ethanone | [CAS]
1159813-33-8 | [Synonyms]
2(1H)-Pyrazinone, 5-acetyl-
1-(5-Hydroxypyrazin-2-yl)ethanone | [Molecular Formula]
C6H6N2O2 | [MDL Number]
MFCD12400925 | [MOL File]
1159813-33-8.mol | [Molecular Weight]
138.12 |
| Chemical Properties | Back Directory | [density ]
1.33±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
10.62±0.40(Predicted) | [InChI]
InChI=1S/C6H6N2O2/c1-4(9)5-2-8-6(10)3-7-5/h2-3H,1H3,(H,8,10) | [InChIKey]
QKRGMTSGTKSZHX-UHFFFAOYSA-N | [SMILES]
C1(=O)NC=C(C(C)=O)N=C1 |
| Hazard Information | Back Directory | [Uses]
1-(5-Hydroxypyrazin-2-yl)ethanone can be used as a key intermediate in the synthesis of pharmaceuticals, particularly in the development of kinase inhibitors for cancer treatment. |
|
| Company Name: |
Cool Pharm, Ltd
|
| Tel: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|