| Identification | Back Directory | [Name]
2H,5H-Pyrano[4,3-b]pyranyl Mupirocin SodiuM IMpurity | [CAS]
116182-44-6 | [Synonyms]
Mupirocin Calcium EP Impurity E Mupirocin EP Impurity E Sodium Salt Mupirocin calcium EP impurity E sodium salt 2H,5H-Pyrano[4,3-b]pyranyl Mupirocin SodiuM IMpurity sodium,9-[(E)-4-[(2R,3S,4aS,7S,8S,8aR)-3,8-dihydroxy-2-[(2S,3S)-3-hydroxybutan-2-yl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyran-7-yl]-3-methylbut-2-enoyl]oxynonanoate [2R-[2α(1S*,2S*),3β,4aα,7β(E),8α,8aβ]]-9-[[4-[hexahydro-3,8-dihydroxy-2-(2-hydroxy-1-Methylpropyl)-2H,5H-pyrano[4,3-b]pyran-7-yl]-3-Methyl-1-oxo-2-butenyl]oxy]nonanoic Acid MonosodiuM Salt Mupirocin calcium EP impurity E sodium saltQ: What is
Mupirocin calcium EP impurity E sodium salt Q: What is the CAS Number of
Mupirocin calcium EP impurity E sodium salt Q: What is the storage condition of
Mupirocin calcium EP impurity E sodium salt Q: What are the applications of
Mupirocin calcium EP impurity E sodium salt | [Molecular Formula]
C26H43NaO9 | [MDL Number]
MFCD31537859 | [MOL File]
116182-44-6.mol | [Molecular Weight]
659 |
| Chemical Properties | Back Directory | [Melting point ]
138-139 °C | [storage temp. ]
Hygroscopic, -20°C Freezer, Under inert atmosphere | [solubility ]
Methanol (Slightly), Water (Slightly) | [form ]
Solid | [color ]
White to Off-White | [Stability:]
Hygroscopic | [InChIKey]
QZCZBJJWMBPAMY-VEBGHWSQNA-N | [SMILES]
O=C(/C=C(/CC1OC[C@H](C[C@H]2C(C(C(C)O)C)O2)[C@@H](O)[C@H]1O)\C)OCCCCCCCCC(=O)O.[Na]C1=CCOC2C=COCC=21 |&1:8,10,18,20,r| |
| Hazard Information | Back Directory | [Uses]
Mupirocin (M794000) impurity. The rearrangement isomer of Mupirocin is prepared using an enzyme-catalyzed, selective deesterification. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-66392521-118 18922260391 |
| Website: |
www.toref.cn/ |
| Company Name: |
Cato Research Chemicals Inc.
|
| Tel: |
+86-020-81960175-877 4000-868-328;4000-868-328 |
| Website: |
www.cato-chem.com/default.aspx?lang=en |
|