| Identification | Back Directory | [Name]
FMOC-LEU-OH-13C6,15N | [CAS]
1163133-36-5 | [Synonyms]
FMOC-LEU-OH-13C6,15N L-Leucine-13C6,15N, N-Fmoc 13C and 15N Labeled Fmoc-Leu L-LEUCINE-13C6,15N, N-FMOC DERIVATIVE N-(9-FLUORENYLMETHOXYCARBONYL)-L-LEUCINE-13C6,15N N-(9-Fluorenylmethoxycarbonyl)-L-Leucine-13C6,15N, L-Leucine-13C6,15N, N-Fmoc | [Molecular Formula]
C21H23NO4 | [MDL Number]
MFCD06798058 | [MOL File]
1163133-36-5.mol | [Molecular Weight]
360.47 |
| Chemical Properties | Back Directory | [Melting point ]
152-156 °C (lit.) | [form ]
solid | [Optical Rotation]
[α]20/D -25°, c =0.5 in DMF | [Major Application]
peptide synthesis | [InChIKey]
CBPJQFCAFFNICX-HNIVWWTASA-N | [SMILES]
[13CH3][13CH]([13CH3])[13CH2][13C@H]([15NH]C(=O)OCC1c2ccccc2-c3ccccc13)[13C](O)=O | [CAS Number Unlabeled]
35661-60-0 |
| Hazard Information | Back Directory | [Uses]
Fmoc-?Leu-?OH-13C6,15N is a useful reagent in the preparation of heavy isotopic form of the FCAT reagents and its use in labeling of tryptic peptides. |
|
| Company Name: |
ChemPep, Inc.
|
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Website: |
www.chempep.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
nanjing
|
| Tel: |
13376084917 13376082704 |
| Website: |
www.linye-e.com/ |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|