| Identification | Back Directory | [Name]
1175018-73-1 | [CAS]
1175018-73-1 | [Synonyms]
N-2-Propene-1yl-2-chloro-R-aminoindane
N-2-propene-1-yl-2-chloro-(R)-aminoindan
1H-Inden-1-amine, N-(2-chloro-2-propen-1-yl)-2,3-dihydro-, (1R)-
N-2-propene-1yl-2-chloro-R-aminoindaneQ: What is
N-2-propene-1yl-2-chloro-R-aminoindane Q: What is the CAS Number of
N-2-propene-1yl-2-chloro-R-aminoindane Q: What is the storage condition of
N-2-propene-1yl-2-chloro-R-aminoindane Q: What are the applications of
N-2-propene-1yl-2-chloro-R-aminoindane | [Molecular Formula]
C12H14ClN | [MOL File]
1175018-73-1.mol | [Molecular Weight]
207.7 |
| Hazard Information | Back Directory | [Uses]
N-Despropargyl N-(2-Chloroallyl) Rasagiline is used in the preparation of Rasagiline mesylate and chloro derivative impurities. Also, a derivative compound of Rasagiline mesylate (R126000) that functions an irreversible MAO-B inhibitor and also as an antiparkinsonian agent. |
|
|