| Identification | Back Directory | [Name]
1,1'-Biphenyl, 4-(3-buten-1-yl)-4'-methyl- | [CAS]
117713-14-1 | [Synonyms]
Methyl biphenylbutene 4-(3-Buten-1-yl)-4'-methylbiphenyl 1,1'-Biphenyl, 4-(3-butenyl)-4'-methyl- 4-(but-3-en-1-yl)-4'-methyl-1,1'-biphenyl 1,1'-Biphenyl, 4-(3-buten-1-yl)-4'-methyl- | [Molecular Formula]
C17H18 | [MDL Number]
MFCD32062865 | [MOL File]
117713-14-1.mol | [Molecular Weight]
222.32 |
| Chemical Properties | Back Directory | [Melting point ]
54 °C | [form ]
powder to crystal | [color ]
White to Almost white | [InChI]
InChI=1S/C17H18/c1-3-4-5-15-8-12-17(13-9-15)16-10-6-14(2)7-11-16/h3,6-13H,1,4-5H2,2H3 | [InChIKey]
XOSOYQOUJQMUEH-UHFFFAOYSA-N | [SMILES]
C1(C2=CC=C(C)C=C2)=CC=C(CCC=C)C=C1 |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
TCI Chemicals
|
| Tel: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
|