| Identification | Back Directory | [Name]
3-phenanthreneboronic acid | [CAS]
1188094-46-3 | [Synonyms]
3-phenanthreneboronic acid 3-phenanthrenylboronic acid phenanthren-3-ylboronicacid Boronic acid, B-3-phenanthrenyl- | [Molecular Formula]
C14H11BO2 | [MDL Number]
MFCD16295000 | [MOL File]
1188094-46-3.mol | [Molecular Weight]
222.05 |
| Chemical Properties | Back Directory | [Boiling point ]
479.5±28.0 °C(Predicted) | [density ]
1.26±0.1 g/cm3(Predicted) | [storage temp. ]
Store at room temperature, keep dry and cool | [pka]
8.53±0.30(Predicted) | [Appearance]
White to off-white Solid | [InChI]
InChI=1S/C14H11BO2/c16-15(17)12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9,16-17H | [InChIKey]
UPYVSYVLGOADDG-UHFFFAOYSA-N | [SMILES]
B(C1C=C2C(=CC=1)C=CC1C2=CC=CC=1)(O)O |
| Hazard Information | Back Directory | [Uses]
3-Phenanthreneboronic acid is mainly used as a reagent in palladium-catalyzed coupling reactions (such as the Suzuki-Miyaura coupling reaction) to construct complex phenanthrene derivatives and polycyclic aromatic hydrocarbons (PAHs). |
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|