| Identification | Back Directory | [Name]
(9S)-9-hydroxy-6,7,8,9-tetrahydrocyclohepta[b]pyridin-5-one | [CAS]
1190363-43-9 | [Synonyms]
Pacritinib Impurity 3 Rimegepant Impurity 6 Rimegepant Impurity 63 (9S)-9-hydroxy-6,7,8,9-tetrahydrocyclohepta[b]pyridin-5-one (S)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-one (9S)-6,7,8,9-Tetrahydro-9-hydroxy-5H-cyclohepta[b]pyridin-5-one 5H-Cyclohepta[b]pyridin-5-one, 6,7,8,9-tetrahydro-9-hydroxy-, (9S)- | [Molecular Formula]
C10H11NO2 | [MOL File]
1190363-43-9.mol | [Molecular Weight]
177.2 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C10H11NO2/c12-8-4-1-5-9(13)10-7(8)3-2-6-11-10/h2-3,6,9,13H,1,4-5H2/t9-/m0/s1 | [InChIKey]
ZZNXHQSAOHUNDA-VIFPVBQESA-N | [SMILES]
C12[C@@H](O)CCCC(=O)C1=CC=CN=2 |
| Hazard Information | Back Directory | [Uses]
(9S)-6,7,8,9-Tetrahydro-9-hydroxy-5H-cyclohepta[b]pyridin-5-one, is a building block used in various chemical synthesis such as in the synthesis of various metabolites of calcitonin gene-related peptide receptor antagonist BMS-846372 |
|
| Company Name: |
Abosyn
|
| Tel: |
0512-69561983 13914027025 |
| Website: |
abosyn.cn/ |
|