| Identification | Back Directory | [Name]
SulfaMerazine-13C6 | [CAS]
1196157-80-8 | [Synonyms]
SulfaMerazine-13C6
[13C6]-Sulfamerazine
Sulfamerazine-13C6 Solution, 100μg/mL
Sulfamerazine 13C6Q: What is
Sulfamerazine 13C6 Q: What is the CAS Number of
Sulfamerazine 13C6 Q: What is the storage condition of
Sulfamerazine 13C6 Q: What are the applications of
Sulfamerazine 13C6 | [Molecular Formula]
C11H12N4O2S | [MDL Number]
MFCD16652578 | [MOL File]
1196157-80-8.mol | [Molecular Weight]
270.358 |
| Chemical Properties | Back Directory | [Major Application]
clinical testing | [InChI]
1S/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15)/i2+1,3+1,4+1,5+1,9+1,10+1 | [InChIKey]
QPPBRPIAZZHUNT-PBZDKDNVSA-N | [SMILES]
Cc1ccnc(NS(=O)(=O)[13c]2[13cH][13cH][13c](N)[13cH][13cH]2)n1 |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|