| Identification | Back Directory | [Name]
(3-BroMophenyl)(2,4,6-triMethylphenyl)iodoniuM triflate | [CAS]
1203709-76-5 | [Synonyms]
(3-bromophenyl)(mesityl)iodonium (3-Bromophenyl)mesityliodonium triflate (3-BroMophenyl)(2,4,6-triMethylphenyl)iodoniuM triflate (3-Bromophenyl)(mesityl)iodonium Trifluoromethanesulfonate 3'-bromo-2,4,6-trimethyl(diphenyliodonium) trifluoromethanesulfonate (3-Bromophenyl)(2,4,6-trimethylphenyl)iodonium trifluoromethanesulfonate (3-bromophenyl)-(2,4,6-trimethylphenyl)iodanium,trifluoromethanesulfonate Iodonium, (3-bromophenyl)(2,4,6-trimethylphenyl)-, 1,1,1-trifluoromethanesulfonate (1:1) Iodonium, (3-?bromophenyl)?(2,?4,?6-?trimethylphenyl)?-?, 1,?1,?1-?trifluoromethanesulf?onate (1:1)98.00% | [Molecular Formula]
C16H15BrF3IO3S | [MDL Number]
MFCD20264881 | [MOL File]
1203709-76-5.mol | [Molecular Weight]
551.157 |
| Chemical Properties | Back Directory | [Melting point ]
170 °C | [storage temp. ]
2-8°C, sealed storage, away from moisture | [solubility ]
soluble in Methanol | [form ]
powder to crystal | [color ]
White to Light yellow | [BRN ]
20041340 | [InChI]
InChI=1S/C15H15BrI.CHF3O3S/c1-10-7-11(2)15(12(3)8-10)17-14-6-4-5-13(16)9-14;2-1(3,4)8(5,6)7/h4-9H,1-3H3;(H,5,6,7)/q+1;/p-1 | [InChIKey]
QTQFCDQRJRJUAN-UHFFFAOYSA-M | [SMILES]
[I+](C1=CC=CC(Br)=C1)C1=C(C)C=C(C)C=C1C.S(C(F)(F)F)([O-])(=O)=O |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
TCI Chemicals
|
| Tel: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
|