| Identification | Back Directory | [Name]
Phen-2,3,4,5-d4-ol, 6-amino- | [CAS]
121887-11-4 | [Synonyms]
2-Aminophenol-d4 MesalazineEPImpurityC-d4 2-aminophen-3,4,5,6-d4-ol Phen-2,3,4,5-d4-ol, 6-amino- Mesalazine (Mesalamine) EP Impurity C-d4 Mesalazine (Mesalamine) EP Impurity C-d4Q: What is
Mesalazine (Mesalamine) EP Impurity C-d4 Q: What is the CAS Number of
Mesalazine (Mesalamine) EP Impurity C-d4 | [Molecular Formula]
C6H3D4NO | [MOL File]
121887-11-4.mol | [Molecular Weight]
109.13 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C6H7NO/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2/i1D,2D,3D,4D | [InChIKey]
CDAWCLOXVUBKRW-RHQRLBAQSA-N | [SMILES]
NC1C([2H])=C([2H])C([2H])=C([2H])C=1O |
| Hazard Information | Back Directory | [Uses]
2-Aminophenol-d4 is the labeled analogue of 2-Aminophenol (A618930), an isomer of 4-Aminophenol (A618920) and is used as a reagent for the synthesis of heterocyclic compounds and dyes. |
|
| Company Name: |
Energy Chemical Gold
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Energy Chemical Gold
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
China Langchem Inc.
|
| Tel: |
021-58956006,021-58950017 15800617331 |
| Website: |
www.isotopemall.com/ |
| Company Name: |
TOSUN PHARM
|
| Tel: |
61855200 13326451905 |
| Website: |
www.toref.cn/ |
|