| Identification | Back Directory | [Name]
N4-Acetyl-O5′-(4,4′-dimethoxytrityl)-O2′-(1,1-dioxothiomorpholine-4-thiocarbonyl)cytidine O3′-(O-(2-cyanoethyl)-N,N-diisopropylphosphoramidite) | [CAS]
1219089-87-8 | [Synonyms]
DMT-2′O-TC-rC(ac) Phosphoramidite
DMT-22O-TC-rC(ac) Phosphoramidite
DMT-2'O-TC-rC(ac) Phosphoramidite configured for ABI
N4-Acetyl-O5′-(4,4′-dimethoxytrityl)-O2′-(1,1-dioxothiomorpholine-4-thiocarbonyl)cytidine O3′-(O-(2-cyanoethyl)-N,N-diisopropylphosphoramidite)
Cytidine, N-acetyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-, 3'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite] 2'-(1,1-dioxido-4-thiomorpholinecarbothioate) | [Molecular Formula]
C46H57N6O11PS2 | [MDL Number]
MFCD19105652 | [MOL File]
1219089-87-8.mol | [Molecular Weight]
965.09 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [solubility ]
acetonitrile: toluene (1:1): soluble0.1M at 18°C, clear | [form ]
solid | [pka]
10.13±0.20(Predicted) | [color ]
white to light yellow | [InChIKey]
OUGOPIOQANCAOY-JFALYFJISA-N | [SMILES]
COc1ccc(cc1)C(OC[C@H]2O[C@H]([C@H](OC(=S)N3CCS(=O)(=O)CC3)[C@@H]2OP(OCCC#N)N(C(C)C)C(C)C)N4C=CC(NC(C)=O)=NC4=O)(c5ccccc5)c6ccc(OC)cc6 |
| Hazard Information | Back Directory | [Uses]
DMT-2′O-TC-rC(ac) Phosphoramidite belongs to TC RNA Phosphoramidites. These highly regarded, innovative monomers allow faster and more efficient RNA-based oligonucleotide manufacturing and the potential to build longer RNA oligonucleotides (>100 bases). TC RNA Phosphoramidites streamline the deprotection process resulting in consistently high-quality products, offering time and cost savings. |
|
| Company Name: |
NewCan Biotech Limited
|
| Telephone: |
+86-571-86912261 19975279805 |
| Website: |
https://www.newcanbio.com/ |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
shanghai Kezx
|
| Telephone: |
18017817217 13770021960 |
| Website: |
http://www.kezxbio.com/ |
|