| Identification | Back Directory | [Name]
Bicyclo[2.2.1]hept-5-ene-2-acetic acid, 2,5-dioxo-1-pyrrolidinyl ester | [CAS]
1234203-45-2 | [Synonyms]
5-Norbornene-2-acetic acid NHS 5-Norbornene-2-acetic acid succinimidyl ester 5-Norbornene-2-acetic acid succinimidyl ester 97% 2,5-Dioxopyrrolidin-1-yl 2-(bicyclo[2.2.1]hept-5-en-2-yl)acetate Bicyclo[2.2.1]hept-5-ene-2-acetic acid N-hydroxysuccinimide ester Bicyclo[2.2.1]hept-5-ene-2-acetic acid, 2,5-dioxo-1-pyrrolidinyl ester 2,5-Dioxopyrrolidin-1-yl 2-(bicyclo[2.2.1]hept-5-en-2-yl)acetate, 5-Norbornene-2-acetic acid NHS, Bicyclo[2.2.1]hept-5-ene-2-acetic acid N-hydroxysuccinimide ester, Bicyclo[2.2.1]hept-5-ene-2-acetic acid, 2,5-dioxo-1-pyrrolidinyl ester | [Molecular Formula]
C13H15NO4 | [MDL Number]
MFCD24386386 | [MOL File]
1234203-45-2.mol | [Molecular Weight]
249.26 |
| Chemical Properties | Back Directory | [Melting point ]
115-120°C | [storage temp. ]
2-8°C | [form ]
solid | [InChI]
1S/C13H15NO4/c15-11-3-4-12(16)14(11)18-13(17)7-10-6-8-1-2-9(10)5-8/h1-2,8-10H,3-7H2 | [InChIKey]
AOGNOQQTUYLDKN-UHFFFAOYSA-N | [SMILES]
O=C(N1OC(C[C@H]2[C@@H]3C=C[C@@H](C3)C2)=O)CCC1=O |
| Safety Data | Back Directory | [Hazard Codes ]
Xn | [Risk Statements ]
22 | [WGK Germany ]
3 | [Storage Class]
11 - Combustible Solids | [Hazard Classifications]
Acute Tox. 4 Oral |
| Hazard Information | Back Directory | [Uses]
5-Norbornene-2-acetic acid succinimidyl ester is used as a reagent in the development of a bioorthogonal and highly efficient conjugation method for quantum dots using tetrazine-norbornene cycloadditions. | [reaction suitability]
reaction type: click chemistry reagent type: linker |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
TargetMol
|
| Tel: |
400-821-0310 15002144251 |
| Website: |
www.targetmol.cn/ |
|