| Identification | Back Directory | [Name]
N-(TRIPHENYLPHOSPHORANYLIDENE)-1H-BENZOTRIAZOLE-1-METHANAMINE | [CAS]
124316-00-3 | [Synonyms]
N-(triphenylphosphoranylidene)-1H-benzo-triazole- benzotriazol-1-ylmethylimino(triphenyl)-$l^{5}-phosphane 1-[[(Triphenylphosphoranylidene)amino]methyl]benzotriazole benzotriazol-1-ylmethylimino(triphenyl)-λsup5sup-phosphane N-(TRIPHENYLPHOSPHORANYLIDENE)-1H-BENZOTRIAZOLE-1-METHANAMINE 1H-Benzotriazole-1-methanamine, N-(triphenylphosphoranylidene)- N-(Triphenylphosphoranylidene)-1H-benzotriazole-1-methanamine 90% N-(Triphenylphosphoranylidene)-1H-benzotriazole-1-MethanaMine,90% | [Molecular Formula]
C25H21N4P | [MDL Number]
MFCD00274644 | [MOL File]
124316-00-3.mol | [Molecular Weight]
408.43 |
| Chemical Properties | Back Directory | [Melting point ]
116-122 °C (lit.) | [InChI]
1S/C25H21N4P/c1-4-12-21(13-5-1)30(22-14-6-2-7-15-22,23-16-8-3-9-17-23)26-20-29-25-19-11-10-18-24(25)27-28-29/h1-19H,20H2 | [InChIKey]
IOSUDUVEOWKKBL-UHFFFAOYSA-N | [SMILES]
C(N=P(c1ccccc1)(c2ccccc2)c3ccccc3)n4nnc5ccccc45 |
| Hazard Information | Back Directory | [Uses]
Reactant for:
- Grignard reaction
- Preparation of N,N-Bis(but-3-enyl)amines via aza-Wittig reaction with aldehydes, followed by a double Grignard reaction with allylmagnesium bromide
- Organic synthesis of N-alkyliminophosphoranes and a-functionalized N-alkyliminophosphoranes
| [reaction suitability]
reaction type: C-C Bond Formation |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|