| Identification | Back Directory | [Name]
METHYL (2S,3R)-(-)-2,3-DIHYDROXY-3-PHENYLPROPIONATE | [CAS]
124649-67-8 | [Synonyms]
METHYL (2S,3R)-2,3-DIHYDROXY-3-PHENYLPROPIONATE (2S,3R)-Methyl 2,3-dihydroxy-3-phenylpropanoate methyl (2S,3R)-(-)-2,3-dihydroxy-3-phenyl-propion METHYL (2S,3R)-(-)-2,3-DIHYDROXY-3-PHENYLPROPIONATE Benzenepropanoic acid, α,β-dihydroxy-, methyl ester, (αS,βR)- | [Molecular Formula]
C10H12O4 | [MDL Number]
MFCD09865001 | [MOL File]
124649-67-8.mol | [Molecular Weight]
196.2 |
| Chemical Properties | Back Directory | [Melting point ]
85-88 °C (lit.) | [Boiling point ]
345.2±9.0 °C(Predicted) | [density ]
1.266±0.06 g/cm3(Predicted) | [pka]
12.33±0.20(Predicted) | [Optical Rotation]
[α]21/D 10°, c = 1 in chloroform | [InChI]
1S/C10H12O4/c1-14-10(13)9(12)8(11)7-5-3-2-4-6-7/h2-6,8-9,11-12H,1H3/t8-,9+/m1/s1 | [InChIKey]
IXDRYSIPXMREGK-BDAKNGLRSA-N | [SMILES]
COC(=O)[C@@H](O)[C@H](O)c1ccccc1 |
| Hazard Information | Back Directory | [Uses]
Methyl (2S,3R)-(?)-2,3-dihydroxy-3-phenylpropionate can be used to synthesize methyl(2R,3R)-2,3-epoxy-3-phenylpropionate, a key intermediate for the preparation of taxol side chain. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|