| Identification | Back Directory | [Name]
YTTERBIUM(III) IONOPHORE I | [CAS]
125110-14-7 | [Synonyms]
Cefixime (1097658)
CefiximeTrihydrate (CFX), 95-101%
Ytterbium(III) ionophore I,Cefixime trihydrate
(6R,7R)-7-((Z)-2-(2-aMinothiazol-4-yl)-2-((carboxyMethoxy)iMino)acetaMido)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid trihydrate
Cefixime trihydrateQ: What is
Cefixime trihydrate Q: What is the CAS Number of
Cefixime trihydrate Q: What is the storage condition of
Cefixime trihydrate | [Molecular Formula]
C16H15N5O7S2.3H2O | [MDL Number]
MFCD03788802 | [MOL File]
125110-14-7.mol | [Molecular Weight]
507.499 |
| Chemical Properties | Back Directory | [Melting point ]
218-225℃ | [RTECS ]
XI0367200 | [form ]
Powder | [Water Solubility ]
Soluble in water at 55.1 μg/mL | [Sensitive ]
Air & Light Sensitive | [Major Application]
microbiology | [InChIKey]
HPRLWADTNARROR-BMSWSOSENA-N | [SMILES]
C(C1=C(CS[C@]2([H])[C@H](NC(=O)/C(/C3=CSC(N)=N3)=N\OCC(=O)O)C(=O)N12)C=C)(=O)O.O |&1:5,7,r| |
|
| Company Name: |
Alfa Omega Pharma
|
| Tel: |
+91-8050045945 +91-9972665399 |
| Website: |
www.www.NOWEBSITE |
| Company Name: |
LGM Pharma
|
| Tel: |
1-(800)-881-8210 |
| Website: |
www.lgmpharma.com |
|