| Identification | Back Directory | [Name]
CHLORODIMETHYL(2,3,4,5-TETRAMETHYL-2,4-CYCLOPENTADIEN-1-YL)SILANE | [CAS]
125542-03-2 | [Synonyms]
chlorodimethyl(2,3,4,5-tetramethyl-2,4-cyclopenta 1,3-Cyclopentadiene, 5-(chlorodimethylsilyl)-1,2,3,4-tetramethyl- Chlorodimethyl(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane CHLORODIMETHYL(2,3,4,5-TETRAMETHYL-2,4-CYCLOPENTADIEN-1-YL)SILANE ChlorodiMethyl(2,3,4,5-tetraMethyl-2,4-cyclopentadien-1-yl)silane 97% | [Molecular Formula]
C11H19ClSi | [MDL Number]
MFCD00674029 | [MOL File]
125542-03-2.mol | [Molecular Weight]
214.81 |
| Chemical Properties | Back Directory | [Boiling point ]
50 °C0.05 mm Hg(lit.) | [density ]
0.972 g/mL at 25 °C(lit.) | [refractive index ]
n20/D 1.496(lit.) | [Fp ]
133 °F | [InChI]
1S/C11H19ClSi/c1-7-8(2)10(4)11(9(7)3)13(5,6)12/h11H,1-6H3 | [InChIKey]
QTMBNCMQGRJAAA-UHFFFAOYSA-N | [SMILES]
CC1=C(C)C(C)=C(C)C1[Si](C)(C)Cl |
| Hazard Information | Back Directory | [Uses]
Chlorodimethyl(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane is used in the preparation of organometallic catalysts on silica supports. |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Infinity SCI
|
| Telephone: |
400-106-2016 17800804092 |
| Website: |
http://www.infsci.com |
| Company Name: |
Domole Scientific
|
| Telephone: |
13275595566; 13275595566 |
| Website: |
http://www.domole.com/ |
| Company Name: |
Finetech Industry Limited
|
| Telephone: |
+86-27-8746-5837 +86-18627785180 |
| Website: |
https://www.finetechnology-ind.com/ |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
|