| Identification | Back Directory | [Name]
Chloro(pentaMethylcyclopentadienyl){5-Methoxy-2-{1-[(4-Methoxyphenyl)iMino-kN]ethyl}phenyl-kC}iridiuM(III), 99% Iridicycle-MeO | [CAS]
1258964-48-5 | [Synonyms]
Chloro(5-methoxy-2-{1-[(4-methoxyphenyl)imino-N]ethyl}phenyl-C)(1,2,3,4,5-pentamethylcyclopentadienyl)iridium(III)
Chloro(pentaMethylcyclopentadienyl){5-Methoxy-2-{1-[(4-Methoxyphenyl)iMino-kN]ethyl}phenyl-kC}iridiuM(III), 99% Iridicycle-MeO
Chloro[5-methoxy-2-[1-[(4-methoxyphenyl)imino-N]ethyl]phenyl- C][(1,2,3,4,5-η)-1,2,3,4,5-pentamethyl-2,4-cyclopenta dien-1-yl]iridium | [EINECS(EC#)]
200-838-9 | [Molecular Formula]
C26H31ClIrNO2 | [MDL Number]
MFCD22666046 | [MOL File]
1258964-48-5.mol | [Molecular Weight]
617.21 |
| Chemical Properties | Back Directory | [Melting point ]
200-239°C | [form ]
Powder | [color ]
orange | [InChI]
1S/C16H16NO2.C5H5.ClH.Ir/c1-12(13-4-8-15(18-2)9-5-13)17-14-6-10-16(19-3)11-7-14;1-2-4-5-3-1;;/h4,6-11H,1-3H3;1-5H;1H;/q;;;+1/p-1/b17-12+;;; | [InChIKey]
JZDNDPJBPBFFCT-DPSBJRLESA-M | [SMILES]
[CH]1[CH][CH][CH][CH]1.COc2ccc(cc2)\N=C(/C)c3ccc(OC)cc3[Ir]Cl | [CAS DataBase Reference]
1258964-48-5 |
| Questions And Answer | Back Directory | [Reaction]
- A versatile catalyst for reductive amination by hydrogen transfer.
- Acceptorless dehydrogenation of nitrogen heterocycles with a versatile iridium catalyst.
|
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|