| Identification | Back Directory | [Name]
6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester | [CAS]
127094-58-0 | [Synonyms]
Ethyl 6-chloro-4-oxo-1H-1,5-naphthyridine-3-carboxylate 6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester 1,5-Naphthyridine-3-carboxylic acid, 6-chloro-4-hydroxy-, ethyl ester | [Molecular Formula]
C11H9ClN2O3 | [MDL Number]
MFCD30723725 | [MOL File]
127094-58-0.mol | [Molecular Weight]
252.65 |
| Chemical Properties | Back Directory | [Boiling point ]
372.7±37.0 °C(Predicted) | [density ]
1.445±0.06 g/cm3(Predicted) | [pka]
1.28±0.50(Predicted) | [InChI]
InChI=1S/C11H9ClN2O3/c1-2-17-11(16)6-5-13-7-3-4-8(12)14-9(7)10(6)15/h3-5H,2H2,1H3,(H,13,15) | [InChIKey]
XNSPDXHNZQVZRQ-UHFFFAOYSA-N | [SMILES]
N1C2C(=NC(Cl)=CC=2)C(O)=C(C(OCC)=O)C=1 |
| Hazard Information | Back Directory | [Description]
6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester, characterized by its nitrogen-containing aromatic ring, has potential as a building block in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. |
|
|