| Identification | Back Directory | [Name]
N,N'-DI-PHENYL-PERYLENE-TETRACARBONIC ACID, DIAMIDE | [CAS]
128-65-4 | [Synonyms]
S1082 DP-PTCDI PTCDI-PH N,N'-DIPHENYL-3,4,9,10-PERYLENEDICARBOXIMIDE N,N'-Diphenyl-3,4:9,10-perylenebisdicarbimide N,N'-Diphenylperylene-3,4:9,10-bis(dicarbimide) N,N'-Diphenyl-3,4,9,10-perylenedicarboximide 98% N,N'-DI-PHENYL-PERYLENE-TETRACARBONIC ACID, DIAMIDE N,N-Diphenyl-3,4:9,10-perylenetetracarboxylic acid diimide N,N'-diphenyl-perylene-3,4,9,10-tetracarbonic acid diimide Perylene-3,4,9,10-tetracarboxylic acid N,N'-diphenyldiimide 2,9-Diphenyl-2,9-diazadibenzo[cd,lm]perylene-1,3,8,10-tetrone 2,9-Diphenyl-anthra2,1,9-def:6,5,10-d'e'f'diisoquinoline-1,3,8,10-tetrone 2,9-diphenylanthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone 2,9-Diphenylanthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone Anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone, 2,9-diphenyl- | [EINECS(EC#)]
204-902-7 | [Molecular Formula]
C36H18N2O4 | [MDL Number]
MFCD00151605 | [MOL File]
128-65-4.mol | [Molecular Weight]
542.54 |
| Chemical Properties | Back Directory | [Melting point ]
>300 °C | [form ]
solid | [semiconductor properties]
N-type (mobility=10-5cm2/V·s) | [λmax]
527 nm | [InChIKey]
OGEZSLXPCKHGKO-UHFFFAOYSA-N | [SMILES]
O=C1N(c2ccccc2)C(=O)c3ccc4c5ccc6C(=O)N(c7ccccc7)C(=O)c8ccc(c9ccc1c3c49)c5c68 |
| Hazard Information | Back Directory | [Uses]
PTCDI-Ph is a conjugating polymer that forms an ultrathin film that can be used in the fabrication of organic field effect transistors (OFETs) for nitrogen dioxide sensor based applications. | [General Description]
N,N′-Diphenyl-3,4,9,10-perylenedicarboximide (PTCDI-Ph) is an asphaltene based conducting polymer that has an archipelago model. It is a perylene diimide derivative that has a high electron affinity and shows good chemical stability. It can be used as an active layer in the development of organic electronic devices. |
|
| Company Name: |
SunaTech Inc.
|
| Tel: |
0512-62872180 18994314770 |
| Website: |
http://www.sunatech.com.cn/ |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 |
| Website: |
www.3achem.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Organtec Ltd
|
| Tel: |
010-89719903 18511074324 |
| Website: |
www.organtec.cn |
|