| Identification | Back Directory | [Name]
(S)--ALLYL-PROLINE HYDROCHLORIDE | [CAS]
129704-91-2 | [Synonyms]
(S)-Alpha-Allyl-ProHCl (S)-a-Allylproline·HCl (S)-α-Allyl-proline·HCl 2-Allyl-D-proline hydrochloride α-allyl-d-proline hydrochloride (s)-α-allyl-proline hydrochloride D-Proline, 2-(2-propenyl)-, hydrochloride (9CI) (S)-2-allylpyrrolidine-2-carboxylic acid hydrochloride (2S)-2-(prop-2-en-1-yl)pyrrolidine-2-carboxylic acid hydrochloride α-Allyl-D-proline hydrochloride, (S)-2-Allyl-2-pyrrolidinecarboxylic acid hydrochloride | [Molecular Formula]
C8H13NO2.ClH | [MDL Number]
MFCD06659238 | [MOL File]
129704-91-2.mol | [Molecular Weight]
191.66 |
| Chemical Properties | Back Directory | [Melting point ]
186-190 °C | [form ]
powder or crystals | [color ]
off-white to brown | [InChI]
InChI=1/C8H13NO2.ClH/c1-2-4-8(7(10)11)5-3-6-9-8;/h2,9H,1,3-6H2,(H,10,11);1H/t8-;/s3 | [InChIKey]
DIYYEOOBZVTROL-DDWIOCJRSA-N | [SMILES]
C(O)(=O)[C@]1(CCCN1)CC=C.Cl |&1:3,r| |
| Hazard Information | Back Directory | [Uses]
(S)-Alpha-allyl-proline Hydrochloride is used in the synthesis of Avrainvillamide and Stephacidins, analogs of these natural products are evaluated as anticancer agents. | [reaction suitability]
reaction type: solution phase peptide synthesis |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Telephone: |
+86-21-61263310 13764994101 |
| Website: |
www.chemicalbook.com/supplier/10480342/ |
| Company Name: |
Nextpeptide Inc
|
| Telephone: |
+86-0571-81612335 +8613336028439 |
| Website: |
http://www.nextpeptide.com/ |
| Company Name: |
Binhai gill polypeptide co. LTD
|
| Telephone: |
021-61263389 13524856427 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList326362/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
|