| Identification | Back Directory | [Name]
Ceftazidime Oxide Impurity | [CAS]
1301254-48-7 | [Synonyms]
Ceftazidime Oxide Impurity Ceftazidime Oxide Impurity 2 Cefathiamidine oxidation Impurity 1(Cefathiamidine oxidation Impurity ) | [Molecular Formula]
C22H22N6O8S2 | [MOL File]
1301254-48-7.mol | [Molecular Weight]
562.57 |
| Chemical Properties | Back Directory | [InChIKey]
FHXSMMLRWXNGCJ-WMDPCPJANA-N | [SMILES]
C(C1=C(CS(=O)[C@]2([H])[C@H](NC(=O)/C(/C3N=C(N)SC=3)=N\OC(C)(C)C(=O)O)C(=O)N12)C[N+]1=CC=CC=C1)(=O)[O-] |&1:6,8,r| |
|
| Company Name: |
PI & PI BIOTECH INC.
|
| Tel: |
+86-13602409664 +86-17788709170 |
| Website: |
www.paypaytech.com/ |
|