| Identification | Back Directory | [Name]
(R)-3-(diMethylaMino)-1-(thiophen-2-yl)propan-1-ol | [CAS]
132335-49-0 | [Synonyms]
9-Bromoquinoxaline Duloxetine Impurity 51 Duloxetine R-Hydroxy Impurity (1R)-3-(Dimethylamino)-1-(2-thienyl)-1-propanol (1R)-3-(dimethylamino)-1-thiophen-2-ylpropan-1-ol (R)-3-(diMethylaMino)-1-(thiophen-2-yl)propan-1-ol 2-Thiophenemethanol, α-[2-(dimethylamino)ethyl]-, (αR)- (R)-(+)- N,N-dimethyl-3-hydroxy-3-(2-thienyl)propanamine | [Molecular Formula]
C9H15NOS | [MDL Number]
MFCD11558915 | [MOL File]
132335-49-0.mol | [Molecular Weight]
185.29 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C(protect from light) | [InChI]
InChI=1/C9H15NOS/c1-10(2)6-5-8(11)9-4-3-7-12-9/h3-4,7-8,11H,5-6H2,1-2H3/t8-/s3 | [InChIKey]
XWCNSHMHUZCRLN-SBYBRXNCNA-N | [SMILES]
[C@@H](C1SC=CC=1)(O)CCN(C)C |&1:0,r| |
| Hazard Information | Back Directory | [Uses]
(R)-3-(Dimethylamino)-1-(thiophen-2-yl)propan-1-ol is useful for the preparation of the duloxetine chiral intermediate, mandelate. |
|
| Company Name: |
Lavybens Pharma
|
| Tel: |
+91-8790466757 +91-8790466756 |
| Website: |
www.lavybenspharma.com |
| Company Name: |
Struchem Co., Ltd.
|
| Tel: |
0512-63009836 18994340901 |
| Website: |
www.beidapharma.com |
| Company Name: |
DebyeTec.com Inc.
|
| Tel: |
18086626237 18086626237 |
| Website: |
www.chemicalbook.com/showsupplierproductslist16955/0.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|