| Identification | Back Directory | [Name]
3-Bromo-9,10-phenanthrenedione | [CAS]
13292-05-2 | [Synonyms]
3-Bromophenanthrenequinone 3-Bromo-9,10-phenanthrenedione 3-Bromo-9,10-phenanthrenequinone 9,10-Phenanthrenedione, 3-bromo- 3-Bromo-9,10-phenanthrenedione ISO 9001:2015 REACH | [Molecular Formula]
C14H7BrO2 | [MDL Number]
MFCD18072876 | [MOL File]
13292-05-2.mol | [Molecular Weight]
287.108 |
| Chemical Properties | Back Directory | [Melting point ]
267-268℃ | [Boiling point ]
447℃ | [density ]
1.638 | [Fp ]
162℃ | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
powder to crystal | [color ]
Light yellow to Brown | [InChI]
InChI=1S/C14H7BrO2/c15-8-5-6-11-12(7-8)9-3-1-2-4-10(9)13(16)14(11)17/h1-7H | [InChIKey]
OFVPOKPVPJPQAY-UHFFFAOYSA-N | [SMILES]
C1=C2C(C3=C(C(=O)C2=O)C=CC=C3)=CC(Br)=C1 |
|
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Telephone: |
0573-85285100 18627885956 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
|