| Identification | Back Directory | [Name]
Lipoamido-PEG8-acid | [CAS]
1334172-70-1 | [Synonyms]
LA-PEG8-COOH LIPOAMIDO-PEG8-COOH Lipoamido-PEG8-acid Lipoamido-dPEG8-acid (R)-Lipoamido-peg8-acid Lipoamido-dPEG(R)8-acid (R)-Lipoamido-PEG8-CH2CH2COOH 4,7,10,13,16,19,22,25-Octaoxa-28-azatritriacontanoic acid, 33-(3R)-1,2-dithiolan-3-yl-29-oxo- | [Molecular Formula]
C27H51NO11S2 | [MDL Number]
MFCD21363243 | [MOL File]
1334172-70-1.mol | [Molecular Weight]
629.82 |
| Chemical Properties | Back Directory | [Boiling point ]
748.3±60.0 °C(Predicted) | [density ]
1.166±0.06 g/cm3(Predicted) | [storage temp. ]
-20°C | [form ]
solid or viscous liquid | [pka]
4.28±0.10(Predicted) | [InChIKey]
ZIKXLXWMWZSKAA-UHFFFAOYSA-N | [SMILES]
OC(CCOCCOCCOCCOCCOCCOCCOCCOCCNC(CCCCC1CCSS1)=O)=O |
| Hazard Information | Back Directory | [Description]
Lipoamido-PEG8-acid contains a lipoic acid group and a carboxylic acid moiety. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. Lipoic acid contains two sulfur atoms (at C6 and C8) connected by a disulfide bond and is thus considered to be oxidized although either sulfur atom can exist in higher oxidation states. The hydrophilic PEG linker increases the water solubility of the compound. | [Uses]
Lipoamido-PEG8-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | [reaction suitability]
reaction type: Pegylations reagent type: chemical modification reagent reagent type: cross-linking reagent reactivity: gold reactive | [IC 50]
PEGs | [References]
[1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|