| Identification | Back Directory | [Name]
PYRIFTALID | [CAS]
135186-78-6 | [Synonyms]
PYRIFTALID CGA 279233 Pyriftalid [iso] PYRIFTALID, PESTANAL pyriftalid (bsi, pa iso) 7-(4,6-DIMETHOXYPYRIMIN-2-YLTHIO)-3-METHYLISOBENZOFURAN-1(3H)-ONE 7-((4,6-DiMethoxypyriMidin-2-yl)thio)-3-Methylisobenzofuran-1(3H)-one (RS)-7-(4,6-dimethyoxypryimidin-2-ylthio)-3-methyl-2-benzofuran-1 (3H)-one | [Molecular Formula]
C15H14N2O4S | [MDL Number]
MFCD06201843 | [MOL File]
135186-78-6.mol | [Molecular Weight]
318.35 |
| Chemical Properties | Back Directory | [Appearance]
m.p.159~160℃ | [Boiling point ]
555.6±60.0 °C(Predicted) | [density ]
1.39±0.1 g/cm3(Predicted) | [storage temp. ]
0-6°C | [form ]
neat | [pka]
-0.47±0.50(Predicted) | [Major Application]
agriculture environmental | [InChI]
1S/C15H14N2O4S/c1-8-9-5-4-6-10(13(9)14(18)21-8)22-15-16-11(19-2)7-12(17-15)20-3/h4-8H,1-3H3 | [InChIKey]
RRKHIAYNPVQKEF-UHFFFAOYSA-N | [SMILES]
COc1cc(OC)nc(Sc2cccc3C(C)OC(=O)c23)n1 |
| Hazard Information | Back Directory | [Chemical Properties]
m.p.159~160℃ | [Uses]
Pyriftalid is a pesticide. | [Definition]
ChEBI: Pyriftalid is a member of 2-benzofurans. | [General Description]
Pyriftalid is a pyrimidinyloxybenzoic herbicide used for the control of grass weeds in rice. Its mode of action involves inhibiting the biosynthesis of amino acids in weeds. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|