| Identification | Back Directory | [Name]
Ascorbic acid 13C6 | [CAS]
1354064-87-1 | [Synonyms]
L-ASCORBIC ACID (VITAMIN C) (13C6, 99%) 500 UG/ML IN WATER:ACETONITRILE Ascorbic acid 13C6Q: What is
Ascorbic acid 13C6 Q: What is the CAS Number of
Ascorbic acid 13C6 Q: What is the storage condition of
Ascorbic acid 13C6 Q: What are the applications of
Ascorbic acid 13C6 | [Molecular Formula]
C6H8O6 | [MDL Number]
MFCD08459699 |
| Chemical Properties | Back Directory | [Melting point ]
193°C | [form ]
powder | [color ]
white to off-white | [InChI]
1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 | [InChIKey]
CIWBSHSKHKDKBQ-RQFYRPEFSA-N | [SMILES]
O[13C]([13C@]([13C@@H](O)[13CH2]O)([H])O1)=[13C](O)[13C]1=O |
| Hazard Information | Back Directory | [Uses]
L-Ascorbic acid-13C6 can be used as a stable isotope internal standard for accurate data interpretation in specific biological samples by LC-MS/MS. |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|