| Identification | Back Directory | [Name]
Perindopril-d4 | [CAS]
1356929-58-2 | [Synonyms]
Perindopril-d4
IPVQLZZIHOAWMC-UQXGGBCESA-N
Perindopril D4Q: What is
Perindopril D4 Q: What is the CAS Number of
Perindopril D4 Q: What is the storage condition of
Perindopril D4 Q: What are the applications of
Perindopril D4 | [Molecular Formula]
C19H28D4N2O5 | [MDL Number]
MFCD11977872 | [MOL File]
1356929-58-2.mol | [Molecular Weight]
372.492 |
| Chemical Properties | Back Directory | [Melting point ]
103-105°C | [Boiling point ]
537.371±45.00 °C(Press: 760.00 Torr)(predicted) | [density ]
1.150±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | [storage temp. ]
-20°C Freezer | [solubility ]
Chloroform (Slightly), Methanol (Slightly) | [form ]
Solid | [pka]
3.151±0.20(predicted) | [color ]
White to Off-White | [InChIKey]
IPVQLZZIHOAWMC-ZBXUOUEYNA-N | [SMILES]
N1(C(=O)[C@@]([2H])(N[C@@H](CCC)C(OCC)=O)C([2H])([2H])[2H])[C@]2([H])[C@@]([H])(CCCC2)C[C@H]1C(O)=O |&1:3,6,19,21,28,r| |
| Hazard Information | Back Directory | [Uses]
Perindopril-d4 is the labeled analogue of Perindopril (P287500), an angiotensin-converting enzyme (ACE) inhibitor. Antihypertensive. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|