| Identification | Back Directory | [Name]
Fmoc-L-Photo-Leucine | [CAS]
1360651-24-6 | [Synonyms]
L-PhotoLeu-OH Fmoc-L-photo-Leu Fmoc-L-Photo-Leucine 3H-Diazirine-3-propanoic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3-methyl-, (αS)- | [Molecular Formula]
C20H19N3O4 | [MDL Number]
MFCD31380715 | [MOL File]
1360651-24-6.mol | [Molecular Weight]
365.38 |
| Chemical Properties | Back Directory | [density ]
1.41±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [form ]
powder | [pka]
3.67±0.10(Predicted) | [color ]
White to off-white | [Major Application]
peptide synthesis | [InChI]
1S/C20H19N3O4/c1-20(22-23-20)10-17(18(24)25)21-19(26)27-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16-17H,10-11H2,1H3,(H,21,26)(H,24,25)/t17-/m0/s1 | [InChIKey]
GDWMJFRPAHGSDU-KRWDZBQOSA-N | [SMILES]
N([C@@H](CC4(N=N4)C)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| Hazard Information | Back Directory | [Uses]
Fmoc-L-Photo-Leucine is a diazirine-containing, Fmoc-protected leucine amino acid and multifunctional photo-crosslinker. Its incorporation into peptides or small-molecule probes and tools allows for photoaffinity labeling of cellular targets and protein-protein interactions upon UV light (~360 nm) irradiation to form a covalent bond. This and other multifunctional probe building blocks will continue to accelerate drug discovery research for probing cellular mechanisms, target ID/validation, and understanding traditionally undruggable targets. An unprotected version is also available as 907278. | [reaction suitability]
reaction type: Fmoc solid-phase peptide synthesis |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Telephone: |
+86-21-61263310 13764994101 |
| Website: |
www.chemicalbook.com/supplier/10480342/ |
| Company Name: |
Binhai gill polypeptide co. LTD
|
| Telephone: |
021-61263389 13524856427 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList326362/0_EN.htm |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|