| Identification | Back Directory | [Name]
XD14 | [CAS]
1370888-71-3 | [Synonyms]
XD14 CS-2672 XD 14;XD-14 4-Acetyl-N-[5-[(diethylamino)sulfonyl]-2-hydroxyphenyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide | [Molecular Formula]
C20H27N3O5S | [MDL Number]
MFCD23144071 | [MOL File]
1370888-71-3.mol | [Molecular Weight]
421.51 |
| Chemical Properties | Back Directory | [density ]
1.300±0.06 g/cm3(Predicted) | [form ]
Solid | [pka]
7.47±0.50(Predicted) | [color ]
Off-white to light yellow | [InChI]
InChI=1S/C20H27N3O5S/c1-6-15-18(13(5)24)12(4)21-19(15)20(26)22-16-11-14(9-10-17(16)25)29(27,28)23(7-2)8-3/h9-11,21,25H,6-8H2,1-5H3,(H,22,26) | [InChIKey]
DPBKLIVPNYGQQG-UHFFFAOYSA-N | [SMILES]
N1C(C)=C(C(C)=O)C(CC)=C1C(NC1=CC(S(N(CC)CC)(=O)=O)=CC=C1O)=O |
| Hazard Information | Back Directory | [Uses]
4-Acetyl-N-[5-[(diethylamino)sulfonyl]-2-hydroxyphenyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide is a bromodomain and extra-terminal (BET) inhibitor and exerts a strong inhibitory potential on the proliferation of specific leukemia cell lines. | [IC 50]
BRD2: 170 nM (Kd); BRD3: 380 nM (Kd); BRD4: 160 nM (Kd) |
|
| Company Name: |
ChemeGen Gold
|
| Tel: |
18818260767 |
| Website: |
https://www.chemegen.com |
| Company Name: |
Twochem Co.Ltd.
|
| Tel: |
021-58111628 15800915896 |
| Website: |
cn.twochem.com |
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Website: |
https://www.bocsci.com |
| Company Name: |
Cckinase, Inc.
|
| Tel: |
+1 (732)236-3202 |
| Website: |
www.cckinase.com |
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 13348960310; |
| Website: |
https://www.weikeqi-biotech.com/ |
|