| Chemical Properties | Back Directory | [Melting point ]
370.93 °C | [form ]
powder or crystals | [SMILES]
FC1=CC([Ir]2(C3=C4C(F)=CC(F)=C3)([N]5=C4C=C(C(C)(C)C)C=C5)([N]6=C7C=C(C(C)(C)C)C=C6)[N]8=C(C9=C2C=C(F)C=C9F)C=C(C(C)(C)C)C=C8)=C7C(F)=C1 |
| Hazard Information | Back Directory | [Uses]
Ir[dF(t-Bu)-ppy]3 is a photocatalyst that readily facilitates the decarboxylative arylation of α-amino acids using visible light. | [reaction suitability]
core: iridium
reagent type: catalyst
reaction type: Photocatalysis |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|