| Identification | Back Directory | [Name]
1,1,1-TRIMETHYL-N-(TRIPHENYLPHOSPHORANYLIDENE)SILANAMINE | [CAS]
13892-06-3 | [Synonyms]
N-Trimethylsilyliminotriphenylphosphorane Triphenyl(trimethylsilylimino)phosphorane N-(Trimethylsilyl)triphenylphosphine imide Triphenyl-N-(trimethylsilyl)phosphine imide triphenyl(trimethylsilylimino)-$l^{5}-phosphane Trimethyl(triphenylphosphoranylideneamino)silane N-(Trimethylsilyl)-P,P,P-triphenylphosphine imide 1,1,1-trimethyl-N-(triphenylphosphoranyl-idene)si Phosphine imide, P,P,P-triphenyl-N-(trimethylsilyl)- 1,1,1-TRIMETHYL-N-(TRIPHENYLPHOSPHORANYLIDENE)SILANAMINE α,α,α-Trimethyl-N-(triphenylphosphoranylidene)silanamine Silanamine, 1,1,1-trimethyl-N-(triphenylphosphoranylidene)- | [Molecular Formula]
C21H24NPSi | [MDL Number]
MFCD01321268 | [MOL File]
13892-06-3.mol | [Molecular Weight]
349.48 |
| Chemical Properties | Back Directory | [Melting point ]
76-82 °C (lit.) | [Boiling point ]
170-171 °C(Press: 0.06 Torr) | [density ]
1.00±0.1 g/cm3(Predicted) | [form ]
solid | [InChI]
1S/C21H24NPSi/c1-24(2,3)22-23(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3 | [InChIKey]
YTKOPFGRNPVCPE-UHFFFAOYSA-N | [SMILES]
C[Si](C)(C)N=P(c1ccccc1)(c2ccccc2)c3ccccc3 |
| Hazard Information | Back Directory | [Uses]
1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine is a reagent used in the synthesis of febrifugine derivatives and in the development of effective and safer tetrahydroquinazoline-type antimalarial. | [General Description]
1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine is an organic building block. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|