| Identification | Back Directory | [Name]
2-((3R,5R)-3,5-bis(tert-butyldiMethylsilyloxy)cyclohexylidene)ethanol | [CAS]
139356-37-9 | [Synonyms]
Paricalcitol-7 Paricalcitol Impurity 9 Paricalcitol intermediate 2-((3R,5R)-3,5-bis(tert-butyldiMethylsilyloxy)cyclohexylidene)ethanol 2-((3R,5R)-3,5-bis((tert-butyldimethylsilyl)oxy)cyclohexylidene)ethan-1-ol 2-[(3R,5R)-3,5-Bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]cyclohexylidene]ethanol Ethanol, 2-[(3R,5R)-3,5-bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]cyclohexylidene]- Paricalcitol impurity 6/2-((3R,5R)-3,5-bis((tert-butyldimethylsilyl)oxy)cyclohexylidene)ethan-1-ol (Z)-2-((3R,5R)-3-((tert-butyldiMethylsilyl)oxy)-5-((isopropyldiMethylsilyl)oxy)cyclohexylidene)ethanol | [Molecular Formula]
C20H42O3Si2 | [MDL Number]
MFCD22125311 | [MOL File]
139356-37-9.mol | [Molecular Weight]
386.72 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C20H42O3Si2/c1-19(2,3)24(7,8)22-17-13-16(11-12-21)14-18(15-17)23-25(9,10)20(4,5)6/h11,17-18,21H,12-15H2,1-10H3/t17-,18-/m1/s1 | [InChIKey]
YDSSQNPZARKZPC-QZTJIDSGSA-N | [SMILES]
C(O)/C=C1/C[C@@H](O[Si](C(C)(C)C)(C)C)C[C@H](O[Si](C(C)(C)C)(C)C)C/1 |
|
| Company Name: |
2Y-Chem, Ltd.
|
| Tel: |
021-51320090 |
| Website: |
www.2ychem.com |
|