| Identification | Back Directory | [Name]
5-chloro-2-(piperidin-4-yl)pyrimidine hydrochloride | [CAS]
1402666-88-9 | [Synonyms]
5-CHLORO-2-(PIPERIDIN-4-YL)PYRIMIDINE HCL 5-chloro-2-(piperidin-4-yl)pyrimidine hydrochloride | [Molecular Formula]
C9H13Cl2N3 | [MDL Number]
MFCD26407085 | [MOL File]
1402666-88-9.mol | [Molecular Weight]
234.126 |
| Chemical Properties | Back Directory | [storage temp. ]
Store at room temperature, keep dry and cool | [Appearance]
White to off-white Solid | [InChI]
InChI=1S/C9H12ClN3.ClH/c10-8-5-12-9(13-6-8)7-1-3-11-4-2-7;/h5-7,11H,1-4H2;1H | [InChIKey]
JCZGAYXHGSPADO-UHFFFAOYSA-N | [SMILES]
ClC1=CN=C(C2CCNCC2)N=C1.Cl |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
TaiChem Taizhou Limited
|
| Tel: |
052386810091 |
| Website: |
https://www.chemicalbook.com/supplier/11410902/1.htm |
|